18740-26-6 Usage
Description
(Thieno[2,3-d]pyrimidin-4-ylthio)acetic acid, also known as TPAA, is a chemical compound that belongs to the thienopyrimidine class. It features a thiol group and a carboxylic acid group, which contribute to its potential pharmaceutical applications. TPAA is currently under investigation for its use in the development of new drugs to treat a range of diseases, including cancer, inflammation, and neurological disorders.
Uses
Used in Pharmaceutical Industry:
(Thieno[2,3-d]pyrimidin-4-ylthio)acetic acid is used as a potential candidate for the development of new drugs for the treatment of various diseases. Its unique chemical structure allows it to potentially act as an inhibitor of certain enzymes or receptors in the body, making it a promising option for targeted treatment of specific conditions.
Used in Cancer Treatment Research:
TPAA is being explored for its potential role in the treatment of cancer. Its ability to inhibit specific enzymes or receptors may contribute to the development of targeted therapies for various types of cancer.
Used in Inflammation Treatment Research:
In addition to cancer, TPAA is also being investigated for its potential use in treating inflammatory conditions. Its interaction with enzymes or receptors involved in inflammation may lead to the development of novel anti-inflammatory drugs.
Used in Neurological Disorder Treatment Research:
TPAA's potential applications extend to the treatment of neurological disorders. Research is ongoing to determine its effectiveness in targeting specific enzymes or receptors associated with these conditions, potentially leading to the development of new therapeutic options.
Check Digit Verification of cas no
The CAS Registry Mumber 18740-26-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,7,4 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 18740-26:
(7*1)+(6*8)+(5*7)+(4*4)+(3*0)+(2*2)+(1*6)=116
116 % 10 = 6
So 18740-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O2S2/c11-6(12)3-14-8-5-1-2-13-7(5)9-4-10-8/h1-2,4H,3H2,(H,11,12)
18740-26-6Relevant articles and documents
QUINOLINONE DERIVATIVES AS METHIONINE ADENOSYLTRANSFERASE 2A INHIBITORS
-
Paragraph 0245, (2021/12/31)
Disclosed herein are certain quinolinone derivatives of Formula (A) that are methionine adenosyltransferase 2A (MAT2A) inhibitors. Also disclosed are pharmaceutical compositions comprising such compounds and methods of treating diseases treatable by inhibition of MAT2A such as cancer, including cancers characterized by reduced or absence of methylthioadenosine phosphorylase (MTAP) activity.
