19225-17-3 Usage
General Description
4,7-Dihydroxy-3-phenylcoumarin is a chemical compound that belongs to the coumarin family. It is a naturally occurring substance found in plants such as the tonka bean and sweet woodruff. This chemical has been studied for its potential biological activities, including antioxidant, anti-inflammatory, and anticoagulant properties. It has also shown potential as a lead compound for the development of new drugs for various conditions. Additionally, 4,7-Dihydroxy-3-phenylcoumarin has been investigated for its potential use in the food and cosmetic industries due to its pleasant aroma and potential health benefits. Overall, this compound has garnered interest for its diverse biological activities and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 19225-17-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,2 and 5 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 19225-17:
(7*1)+(6*9)+(5*2)+(4*2)+(3*5)+(2*1)+(1*7)=103
103 % 10 = 3
So 19225-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H10O4/c16-10-6-7-11-12(8-10)19-15(18)13(14(11)17)9-4-2-1-3-5-9/h1-8,16,18H
