19225-22-0 Usage
Chemical class
Indene-1,3-diones
Structure
A central indene ring system attached to a phenyl group with three methoxy substituents
Properties
Diverse pharmacological activities, including anti-inflammatory, antioxidant, and anticancer properties
Potential applications
Medicinal chemistry and drug discovery
Additional research needed
To fully understand the chemical and biological properties of the compound and its potential use in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 19225-22-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,2 and 5 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 19225-22:
(7*1)+(6*9)+(5*2)+(4*2)+(3*5)+(2*2)+(1*2)=100
100 % 10 = 0
So 19225-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O5/c1-21-13-8-10(9-14(22-2)18(13)23-3)15-16(19)11-6-4-5-7-12(11)17(15)20/h4-9,15H,1-3H3