19244-91-8 Usage
General Description
1,4-bis(2-methylprop-1-enyl)piperazine is a chemical compound with the molecular formula C14H26N2. It is a piperazine derivative, which is commonly used in the synthesis of pharmaceutical compounds and other organic molecules. The compound is a clear, colorless liquid with a characteristic odor, and it is highly soluble in organic solvents such as ethanol and diethyl ether. 1,4-bis(2-methylprop-1-enyl)piperazine exhibits low acute toxicity and is not considered to be a significant environmental or health hazard. Its primary use is as an intermediate in the production of various chemicals and pharmaceuticals, where it serves as a building block for the synthesis of more complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 19244-91-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,4 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19244-91:
(7*1)+(6*9)+(5*2)+(4*4)+(3*4)+(2*9)+(1*1)=118
118 % 10 = 8
So 19244-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H22N2/c1-11(2)9-13-5-7-14(8-6-13)10-12(3)4/h9-10H,5-8H2,1-4H3
