194240-75-0 Usage
Description
4-Chloro-2-fluorophenylacetic acid is an organic compound characterized by its off-white powder form. It is a derivative of phenylacetic acid, featuring a chlorine atom at the 4th position and a fluorine atom at the 2nd position on the benzene ring. This unique structure endows it with specific chemical properties that make it a valuable component in the synthesis of various pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
4-Chloro-2-fluorophenylacetic acid is utilized as a pharmaceutical intermediate for the development of medications. Its distinct chemical structure allows it to serve as a key building block in the synthesis of drugs with targeted therapeutic effects.
As a pharmaceutical intermediate, 4-chloro-2-fluorophenylacetic acid is used for the production of various drugs, particularly those with specific therapeutic applications. Its unique molecular structure contributes to the development of new and innovative medications, enhancing the range of treatment options available in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 194240-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,4,2,4 and 0 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 194240-75:
(8*1)+(7*9)+(6*4)+(5*2)+(4*4)+(3*0)+(2*7)+(1*5)=140
140 % 10 = 0
So 194240-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12)
