20303-31-5 Usage
Description
METHYL 5-(BENZYLOXYCARBONYL)-2,4-DIMETHYL-3-PYRROLEPROPIONATE is a chemical compound that belongs to the pyrrole family. It is characterized by its unique molecular structure, which features a pyrrole ring with a benzyloxycarbonyl group at the 5-position and methyl groups at the 2 and 4 positions. METHYL 5-(BENZYLOXYCARBONYL)-2,4-DIMETHYL-3-PYRROLEPROPIONATE is known for its potential applications in various fields, particularly in chemical synthesis.
Uses
1. Chemical Synthesis Studies:
METHYL 5-(BENZYLOXYCARBONYL)-2,4-DIMETHYL-3-PYRROLEPROPIONATE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block for the development of new molecules with potential applications in pharmaceuticals, materials science, and other areas.
2. Pharmaceutical Industry:
In the pharmaceutical industry, METHYL 5-(BENZYLOXYCARBONYL)-2,4-DIMETHYL-3-PYRROLEPROPIONATE is used as a starting material for the synthesis of novel drug candidates. Its versatile chemical structure enables the development of new therapeutic agents with improved efficacy and selectivity, targeting a wide range of diseases and conditions.
3. Materials Science:
METHYL 5-(BENZYLOXYCARBONYL)-2,4-DIMETHYL-3-PYRROLEPROPIONATE can also be utilized in the field of materials science for the development of advanced materials with unique properties. Its incorporation into polymers and other materials can lead to the creation of new materials with enhanced performance characteristics, such as improved mechanical strength, thermal stability, or chemical resistance.
4. Research and Development:
In academic and industrial research settings, METHYL 5-(BENZYLOXYCARBONYL)-2,4-DIMETHYL-3-PYRROLEPROPIONATE serves as a valuable compound for exploring new reaction pathways and understanding the fundamental principles of organic chemistry. Its use in research can lead to the discovery of new synthetic methods, catalysts, and reaction mechanisms, ultimately contributing to the advancement of chemical science.
Check Digit Verification of cas no
The CAS Registry Mumber 20303-31-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,3,0 and 3 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 20303-31:
(7*2)+(6*0)+(5*3)+(4*0)+(3*3)+(2*3)+(1*1)=45
45 % 10 = 5
So 20303-31-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H21NO4/c1-12-15(9-10-16(20)22-3)13(2)19-17(12)18(21)23-11-14-7-5-4-6-8-14/h4-8,19H,9-11H2,1-3H3
20303-31-5Relevant articles and documents
-
Harbuck,J.W.,Rapoport,H.
, p. 853 - 855 (1971)
-
Synthetic porphyrins bearing β-propionate chains as photosensitizers for photodynamic therapy
Pereira, Nelson,Serra, Arménio C.,Pineiro, Marta,Gonsalves, António M. D'A. Rocha,Abrantes, Margarida,Laranjo, Mafalda,Botelho, Filomena
experimental part, p. 438 - 445 (2010/12/18)
Porphyrins with different numbers of β-propionate chains mimicking natural porphyrins were prepared via the 2+2 MacDonald type approach. Photodynamic activity against WiDr colon adenocarcinoma cells showed that activity is related to the number of β-propi
