206658-90-4 Usage
General Description
3-Aminophthalhydrazide, sodium salt hydrate is a chemical compound that is commonly used as a reagent in organic synthesis. It is a white to off-white powder that is soluble in water. 3-AMINOPHTHALHYDRAZIDE, SODIUM SALT HYDRATE is often utilized as a reagent in the synthesis of various organic compounds and pharmaceuticals. It is also used as a reducing agent in certain chemical reactions. Additionally, it has applications in the field of dye chemistry and can be used as a reagent for the determination of certain metals. 3-AMINOPHTHALHYDRAZIDE, SODIUM SALT HYDRATE is considered to be relatively stable and has low toxicity, making it a versatile and useful chemical in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 206658-90-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,6,5 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 206658-90:
(8*2)+(7*0)+(6*6)+(5*6)+(4*5)+(3*8)+(2*9)+(1*0)=144
144 % 10 = 4
So 206658-90-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2.Na.H2O/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12;;/h1-3H,(H4,9,10,11,12,13);;1H2/q;+1;/p-1/rC8H6N3NaO2.H2O/c9-5-3-1-2-4-6(5)8(14)11(12)10-7(4)13;/h1-3H,9H2,(H,10,13);1H2
