206986-81-4 Usage
Description
2-Chloro-3,5-difluorophenol is a trihalogenated phenol, which is a type of organic compound characterized by the presence of three halogen atoms (in this case, one chlorine and two fluorine atoms) attached to a phenol molecule. It is synthesized from 2,4-difluoroaniline through a series of chemical reactions, including bromination, Sandmeyer reaction, Grignard reaction, and esterification.
Uses
Used in Chemical Synthesis:
2-Chloro-3,5-difluorophenol is used as an intermediate in the chemical synthesis of various compounds. Its unique structure, with a chlorine and two fluorine atoms attached to the phenol molecule, makes it a valuable building block for the creation of a wide range of chemical products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-chloro-3,5-difluorophenol may be utilized as a starting material for the development of new drugs. Its specific properties, such as the presence of halogen atoms, can be exploited to create molecules with desired biological activities, potentially leading to the discovery of novel therapeutic agents.
Used in Agrochemical Industry:
2-Chloro-3,5-difluorophenol can also be employed in the agrochemical industry for the synthesis of various pesticides and herbicides. Its unique chemical structure may contribute to the development of more effective and environmentally friendly products for agricultural use.
Used in Material Science:
In the field of material science, 2-chloro-3,5-difluorophenol may find applications in the development of new materials with specific properties, such as improved thermal stability, chemical resistance, or mechanical strength. Its unique structure can be used to create novel polymers or composites with enhanced performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 206986-81-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,9,8 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 206986-81:
(8*2)+(7*0)+(6*6)+(5*9)+(4*8)+(3*6)+(2*8)+(1*1)=164
164 % 10 = 4
So 206986-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H3ClF2O/c7-6-4(9)1-3(8)2-5(6)10/h1-2,10H