207986-22-9 Usage
General Description
2,3,6-TRIFLUOROBENZAMIDE is a chemical compound with the molecular formula C7H4F3NO. It is a white solid that is commonly used in various chemical and pharmaceutical applications. As a benzamide derivative, it serves as a building block for the synthesis of various organic compounds. Its trifluorinated benzene ring provides unique properties that make it useful in the development of new drugs, agrochemicals, and materials. In addition, 2,3,6-TRIFLUOROBENZAMIDE is also used as a research tool in the study of molecular interactions and in medicinal chemistry research. Overall, this compound's versatile nature and valuable properties make it a valuable asset in various branches of chemistry and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 207986-22-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,9,8 and 6 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 207986-22:
(8*2)+(7*0)+(6*7)+(5*9)+(4*8)+(3*6)+(2*2)+(1*2)=159
159 % 10 = 9
So 207986-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F3NO/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H2,11,12)
