21579-37-3 Usage
General Description
5-Amino-pyridazine-4-carboxylic acid is a chemical compound with the molecular formula C6H5N3O2. It is a derivative of pyridazine and contains an amino group and a carboxylic acid group on the 4th and 5th positions respectively. 5-AMINO-PYRIDAZINE-4-CARBOXYLIC ACID is used in the synthesis of pharmaceuticals and agrochemicals, and its properties make it a useful building block in organic synthesis. Additionally, it has potential applications in the development of new materials and in medicinal chemistry research. Its versatile nature and ability to participate in various chemical reactions make 5-amino-pyridazine-4-carboxylic acid a valuable compound in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 21579-37-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,5,7 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21579-37:
(7*2)+(6*1)+(5*5)+(4*7)+(3*9)+(2*3)+(1*7)=113
113 % 10 = 3
So 21579-37-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-4-2-8-7-1-3(4)5(9)10/h1-2H,(H2,6,7)(H,9,10)
