216485-86-8 Usage
Description
3-Isopropoxyphenylboronic acid is an organic compound with the molecular formula C9H13BO4. It is an off-white solid and is commonly used as a reagent in various chemical reactions and synthesis processes.
Uses
1. Reactant for Synthesis:
3-Isopropoxyphenylboronic acid is used as a reactant for the synthesis of various compounds, including:
a. Heteroaryl benzylureas with glycogen synthase kinase 3 (GSK-3) inhibitory activity, which are important for studying the role of GSK-3 in various cellular processes and diseases.
b. Modulators of survival motor neuron (SMN) protein, which are crucial for understanding and potentially treating spinal muscular atrophy.
c. Inhibitors of cholesteryl ester transfer protein (CETP), which can help in the development of therapies for cardiovascular diseases.
d. Selective sphingosine-1-phosphate receptor subtype-1 agonists, which have potential applications in treating various diseases, including autoimmune disorders and cancer.
e. Cytotoxic open lactone analogs of Lamellarin D, which are being studied for their potential anti-cancer properties.
2. Suzuki Reaction:
3-Isopropoxyphenylboronic acid is used as a reactant in the Suzuki reaction, a widely employed method for the formation of carbon-carbon bonds, particularly in the synthesis of biaryl compounds. The Suzuki reaction is an essential tool in the fields of pharmaceuticals, agrochemicals, and materials science, as it allows for the creation of complex molecular structures with high selectivity and under mild conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 216485-86-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,6,4,8 and 5 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 216485-86:
(8*2)+(7*1)+(6*6)+(5*4)+(4*8)+(3*5)+(2*8)+(1*6)=148
148 % 10 = 8
So 216485-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H13BO3/c1-7(2)13-9-5-3-4-8(6-9)10(11)12/h3-7,11-12H,1-2H3
216485-86-8Relevant articles and documents
Efficiently self-healing boronic ester crystals
Al-Handawi, Marieh B.,Commins, Patrick,Karothu, Durga Prasad,Naumov, Pan?e,Raj, Gijo
, p. 2606 - 2613 (2020/03/23)
The perception of organic crystals being rigid static entities is quickly eroding, and molecular crystals are now matching a number of properties previously thought to be unique to soft materials. Here, we present crystals of a boronate ester that encompass many of the elastic and plastic mechanical properties of polymers such as bending, twisting, coiling and highly efficient self-healing of up to 67%, while they maintain their long-range structural order. The approach utilizes the concept of dynamic covalent chemistry and proves it can be applied towards ordered materials. This work expands our current understanding of the properties of crystalline molecular materials, and it could have implications towards the development of mechanically robust organic crystals that are capable of self-repair for durable all-organic electronics and soft robotics.
