220247-73-4 Usage
General Description
7-Bromo-1,2,3,4-tetrahydroisoquinoline hydrochloride is a chemical compound that is commonly used in research and development of pharmaceuticals. It is a derivative of tetrahydroisoquinoline, which is a heterocyclic compound with potential biological activity. The addition of a bromine atom to the tetrahydroisoquinoline structure alters its properties and can lead to the development of new drugs with improved efficacy and bioavailability. The hydrochloride salt form of this compound increases its solubility in water, making it easier to handle and manipulate in the laboratory. Overall, 7-Bromo-1,2,3,4-tetrahydroisoquinoline hydrochloride has potential applications in the pharmaceutical industry for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 220247-73-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,2,4 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 220247-73:
(8*2)+(7*2)+(6*0)+(5*2)+(4*4)+(3*7)+(2*7)+(1*3)=94
94 % 10 = 4
So 220247-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrN.ClH/c10-9-2-1-7-3-4-11-6-8(7)5-9;/h1-2,5,11H,3-4,6H2;1H