22266-25-7 Usage
Description
[2-(3-ethoxy-3-oxopropyl)cyclohexyl]dimethylammonium hydrogen maleate is a complex quaternary ammonium compound and maleic acid salt, featuring a cyclic cyclohexyl group and a dimethylammonium group, along with ethoxy and oxopropyl groups that contribute to its unique reactivity and properties. The maleate counterion further influences the compound's charge and stability.
Uses
Used in Pharmaceutical Applications:
[2-(3-ethoxy-3-oxopropyl)cyclohexyl]dimethylammonium hydrogen maleate is used as a potential active pharmaceutical ingredient due to its complex structure and functional groups, which may offer specific reactivity or properties beneficial for drug development.
Used in Organic Synthesis:
In the field of organic synthesis, [2-(3-ethoxy-3-oxopropyl)cyclohexyl]dimethylammonium hydrogen maleate is used as a versatile building block or intermediate for the synthesis of various organic compounds, taking advantage of its unique functional groups and reactivity.
Used in Other Industries:
Depending on its specific properties and reactivity, [2-(3-ethoxy-3-oxopropyl)cyclohexyl]dimethylammonium hydrogen maleate may also find applications in other industries, such as materials science, where its unique structure could be utilized for the development of new materials with specific characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 22266-25-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,6 and 6 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22266-25:
(7*2)+(6*2)+(5*2)+(4*6)+(3*6)+(2*2)+(1*5)=87
87 % 10 = 7
So 22266-25-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H25NO2.C4H4O4/c1-4-16-13(15)10-9-11-7-5-6-8-12(11)14(2)3;5-3(6)1-2-4(7)8/h11-12H,4-10H2,1-3H3;1-2H,(H,5,6)(H,7,8)/p-1/b;2-1-
