22280-02-0 Usage
Description
3-METHYL-4-HYDROXYPYRIDINE, also known as 4-Hydroxy-3-methylpyridine, is an organic compound that serves as a crucial building block in the chemical synthesis of various pharmaceutical and biologically active compounds. It is characterized by its unique molecular structure, which features a pyridine ring with a methyl group at the 3rd position and a hydroxyl group at the 4th position. This structure endows it with versatile reactivity and compatibility with a wide range of chemical reactions, making it a valuable intermediate in the development of novel therapeutic agents.
Uses
Used in Pharmaceutical Synthesis:
3-METHYL-4-HYDROXYPYRIDINE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with improved efficacy and selectivity, addressing unmet medical needs.
Used in the Synthesis of GPR119 Agonists:
3-METHYL-4-HYDROXYPYRIDINE is used as an intermediate for the synthesis of second-generation agonists of the orphan G-protein coupled receptor GPR119. These agonists have potential therapeutic applications in the treatment of diabetes, as they can help regulate glucose homeostasis and improve insulin sensitivity.
Used in the Development of Biologically Active Compounds:
3-METHYL-4-HYDROXYPYRIDINE is also used as a building block in the synthesis of biologically active compounds, which can have various applications in the fields of medicine, agriculture, and environmental science. Its versatility in chemical reactions enables the creation of novel molecules with potential therapeutic, pesticidal, or other beneficial properties.
Check Digit Verification of cas no
The CAS Registry Mumber 22280-02-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,8 and 0 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 22280-02:
(7*2)+(6*2)+(5*2)+(4*8)+(3*0)+(2*0)+(1*2)=70
70 % 10 = 0
So 22280-02-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO/c1-5-4-7-3-2-6(5)8/h2-4H,1H3,(H,7,8)
