222987-21-5 Usage
General Description
4-(2-Aminopyrimidin-5-yl)benzoic acid is a chemical compound with the molecular formula C12H10N4O2. It is a derivative of benzoic acid and contains a pyrimidine ring with an amino group attached to it. 4-(2-AMINOPYRIMIDIN-5-YL)BENZOIC ACID belongs to the class of heterocyclic compounds and is commonly used in organic synthesis and medicinal chemistry. It has the potential to act as a ligand in coordination chemistry and can also be used in the production of pharmaceuticals and agrochemicals. Its structure and properties make it a valuable building block for the synthesis of various bioactive compounds. Additionally, it has been studied for its potential pharmacological properties and may have applications in drug development and discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 222987-21-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,2,9,8 and 7 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 222987-21:
(8*2)+(7*2)+(6*2)+(5*9)+(4*8)+(3*7)+(2*2)+(1*1)=145
145 % 10 = 5
So 222987-21-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H9N3O2/c12-11-13-5-9(6-14-11)7-1-3-8(4-2-7)10(15)16/h1-6H,(H,15,16)(H2,12,13,14)
