22572-40-3 Usage
Description
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide, commonly known as EDAC or EDC, is a chemical compound that serves as a crosslinking agent. It is a solid substance with the ability to form amide bonds, making it a versatile reagent in various applications.
Uses
1. Used as a Crosslinking Agent:
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide is used as a crosslinking agent for amidation crosslinking reactions. It facilitates the formation of amide bonds between molecules, which is crucial in various chemical and biological processes.
2. Used in the Pharmaceutical Industry:
In the pharmaceutical industry, 1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide is used as a water-soluble carboxyl modifying reagent. It helps in the modification of proteins and other biomolecules, which is essential for the development of new drugs and therapeutic agents.
3. Used in the Chemical Industry:
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide is also used in the chemical industry for various applications, including the synthesis of polymers and other complex molecules. Its ability to form amide bonds makes it a valuable tool in the development of new materials and chemical products.
4. Used in the Biotechnology Industry:
In the biotechnology industry, 1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide is used for the modification and crosslinking of biomolecules, such as proteins and nucleic acids. This allows for the creation of novel bioconjugates and the development of new biotechnological applications.
5. Used in the Research and Development Sector:
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide is a valuable reagent in the research and development sector, where it is used for the study of molecular interactions and the development of new chemical and biological methods. Its ability to form amide bonds makes it an essential tool in the exploration of new scientific frontiers.
Check Digit Verification of cas no
The CAS Registry Mumber 22572-40-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,5,7 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22572-40:
(7*2)+(6*2)+(5*5)+(4*7)+(3*2)+(2*4)+(1*0)=93
93 % 10 = 3
So 22572-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H17N3.CH3I/c1-4-9-8-10-6-5-7-11(2)3;1-2/h4-7H2,1-3H3;1H3
