22930-85-4 Usage
Description
4-[2-(ethylamino)-1-hydroxypropyl]pyrocatechol hydrochloride is a chemical compound with a complex structure, characterized by its hydroxypropyl and ethylamino groups attached to a pyrocatechol core. 4-[2-(ethylamino)-1-hydroxypropyl]pyrocatechol hydrochloride is a derivative of pyrocatechol, which is a type of catechol, and it has been modified to include an ethylamino and hydroxypropyl group. The hydrochloride salt form of this compound may enhance its solubility and stability in certain applications.
Uses
Used in Pharmaceutical Industry:
4-[2-(ethylamino)-1-hydroxypropyl]pyrocatechol hydrochloride is used as an active pharmaceutical ingredient for the development of bronchodilator drugs. As a dihydroxy N-ethyl analogue of Ephedrine, it possesses bronchodilatory properties, which can help in the treatment of respiratory conditions such as asthma and chronic obstructive pulmonary disease (COPD). The compound's structure allows it to target and relax the smooth muscles in the airways, leading to improved airflow and reduced symptoms.
Used in Chemical Research:
In the field of chemical research, 4-[2-(ethylamino)-1-hydroxypropyl]pyrocatechol hydrochloride can be used as a starting material or intermediate for the synthesis of other complex organic compounds. Its unique structure and functional groups make it a valuable building block for the development of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Drug Delivery Systems:
Similar to gallotannin, 4-[2-(ethylamino)-1-hydroxypropyl]pyrocatechol hydrochloride could potentially be incorporated into drug delivery systems to improve its bioavailability and therapeutic outcomes. By utilizing advanced drug delivery technologies, such as nanoparticles or liposomes, the compound could be more effectively targeted to specific cells or tissues, reducing side effects and increasing its overall efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 22930-85-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,9,3 and 0 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22930-85:
(7*2)+(6*2)+(5*9)+(4*3)+(3*0)+(2*8)+(1*5)=104
104 % 10 = 4
So 22930-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO3.ClH/c1-3-12-7(2)11(15)8-4-5-9(13)10(14)6-8;/h4-7,11-15H,3H2,1-2H3;1H