23139-02-8 Usage
Nitroso compound
A type of organic compound containing a nitroso group (-C=N-O) in its structure.
Reagent in organic synthesis
Commonly used in various chemical reactions to facilitate the formation of complex organic structures.
Nitrosation of amines
Ability to react with amines, forming nitroso compounds through the process of nitrosation.
Formation of complex organic structures
Capable of undergoing reactions that result in the creation of intricate organic molecules.
Building block in pharmaceutical and agrochemical synthesis
Utilized as a starting material or intermediate in the production of drugs and agrochemicals.
Pesticide and herbicide potential
Possesses the ability to inhibit the growth of certain plants, making it a potential candidate for use in pest and weed control.
Limited agricultural application
Despite its potential as a pesticide and herbicide, its use in agriculture is restricted due to concerns about human toxicity and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 23139-02-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,1,3 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 23139-02:
(7*2)+(6*3)+(5*1)+(4*3)+(3*9)+(2*0)+(1*2)=78
78 % 10 = 8
So 23139-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrN3O2/c1-12(11-14)8(13)10-7-4-2-6(9)3-5-7/h2-5H,1H3,(H,10,13)
