23551-34-0 Usage
Description
[2-(4-HYDROXY-PHENYL)-THIAZOL-4-YL]-ACETIC ACID is a chemical compound with the molecular formula C11H9NO3S, characterized as a thiazole derivative featuring a phenyl and hydroxy group attached to the thiazole ring. It is recognized for its potential pharmacological and chemical properties, making it a valuable research tool in drug discovery and development, particularly for anti-inflammatory and analgesic agents.
Uses
Used in Pharmaceutical Industry:
[2-(4-HYDROXY-PHENYL)-THIAZOL-4-YL]-ACETIC ACID is used as a starting point for the synthesis of potential drug candidates due to its potential anti-inflammatory and analgesic properties. Its presence in medicinal chemistry is attributed to the compound's ability to be modified and optimized for specific therapeutic applications.
Used in Antioxidant Research:
As a compound with a hydroxy group, [2-(4-HYDROXY-PHENYL)-THIAZOL-4-YL]-ACETIC ACID is used in research for its potential antioxidant properties, which could be beneficial in the development of treatments for various diseases and conditions associated with oxidative stress.
Used in Chemical Reactions:
Given its status as an acetic acid derivative, [2-(4-HYDROXY-PHENYL)-THIAZOL-4-YL]-ACETIC ACID is used in various chemical reactions for the synthesis of different compounds, taking advantage of its acidic or carboxylic properties to form new chemical entities with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 23551-34-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,5 and 1 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 23551-34:
(7*2)+(6*3)+(5*5)+(4*5)+(3*1)+(2*3)+(1*4)=90
90 % 10 = 0
So 23551-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO3S/c13-9-3-1-7(2-4-9)11-12-8(6-16-11)5-10(14)15/h1-4,6,12H,5H2,(H,14,15)/p-1
