23821-92-3 Usage
General Description
Methyl (2,4-diphenylthiazol-5-yl)acetate is a chemical compound with the molecular formula C14H13NO2S. It is a thiazole derivative that is commonly used in the synthesis of pharmaceuticals and agrochemicals. METHYL (2,4-DIPHENYLTHIAZOL-5-YL)ACETATE is a white to off-white solid with a melting point of approximately 140-145°C. Methyl (2,4-diphenylthiazol-5-yl)acetate is known for its potential biological activities, such as antiviral, antimicrobial, and anti-inflammatory properties. It is also used as a building block in the development of various chemical and pharmaceutical products. Overall, this compound has several industrial and biological applications, making it a valuable chemical in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 23821-92-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,8,2 and 1 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 23821-92:
(7*2)+(6*3)+(5*8)+(4*2)+(3*1)+(2*9)+(1*2)=103
103 % 10 = 3
So 23821-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H15NO2S/c1-21-16(20)12-15-17(13-8-4-2-5-9-13)19-18(22-15)14-10-6-3-7-11-14/h2-11H,12H2,1H3