245057-65-2 Usage
General Description
4-(2-CHLOROPHENOXY)PIPERIDINE is a chemical compound that belongs to the piperidine class of organic compounds. It is characterized by the presence of a piperidine ring with a phenoxy group attached to the fourth position. The chlorophenyl ring also has a chloro substituent at the second position. 4-(2-CHLOROPHENOXY)PIPERIDINE has potential applications in pharmaceutical and chemical research, particularly in the development of new drugs and compounds. Additionally, it may have biological activity and potential therapeutic uses, although further studies are needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 245057-65-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,5,0,5 and 7 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 245057-65:
(8*2)+(7*4)+(6*5)+(5*0)+(4*5)+(3*7)+(2*6)+(1*5)=132
132 % 10 = 2
So 245057-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H14ClNO/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9/h1-4,9,13H,5-8H2