24687-31-8 Usage
Description
3-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)-2-methylprop-1-enyl]benzoselenazolium bromide is a complex organic compound characterized by a selenium core and a benzene ring structure. It features multiple ethyl and methyl groups, along with a bromide ion. As a member of the benzothiazole family, this compound possesses a reactive selenium atom, which may contribute to its potential applications in various fields such as organic synthesis, catalysis, pharmaceuticals, material science, and chemical research and development. Its unique structure could offer distinct properties that warrant further investigation and analysis to fully explore its capabilities and uses.
Uses
Used in Organic Synthesis:
3-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)-2-methylprop-1-enyl]benzoselenazolium bromide is used as a synthetic intermediate for the creation of various organic compounds. Its reactive selenium atom and unique structure facilitate the formation of new chemical bonds and the synthesis of complex molecules.
Used in Catalysis:
In the field of catalysis, 3-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)-2-methylprop-1-enyl]benzoselenazolium bromide serves as a catalyst or a catalyst precursor. Its ability to participate in redox reactions and its electron-rich nature make it a promising candidate for accelerating chemical reactions and improving their efficiency.
Used in Pharmaceutical Research:
3-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)-2-methylprop-1-enyl]benzoselenazolium bromide is utilized in pharmaceutical research as a potential lead compound for the development of new drugs. Its selenium-containing structure may offer novel biological activities and therapeutic properties that could be harnessed for treating various diseases and medical conditions.
Used in Material Science:
In material science, 3-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)-2-methylprop-1-enyl]benzoselenazolium bromide is employed in the development of new materials with unique electronic, optical, or mechanical properties. Its incorporation into polymers, coatings, or other materials may lead to the creation of innovative products with enhanced performance characteristics.
Used in Chemical Research and Development:
3-ethyl-2-[3-(3-ethyl-3H-benzoselenazol-2-ylidene)-2-methylprop-1-enyl]benzoselenazolium bromide is used as a research tool in chemical laboratories to study the properties and reactivity of selenium-containing compounds. Its synthesis and reactions can provide valuable insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 24687-31-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,6,8 and 7 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 24687-31:
(7*2)+(6*4)+(5*6)+(4*8)+(3*7)+(2*3)+(1*1)=128
128 % 10 = 8
So 24687-31-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H23N2Se2/c1-4-23-17-10-6-8-12-19(17)25-21(23)14-16(3)15-22-24(5-2)18-11-7-9-13-20(18)26-22/h6-15H,4-5H2,1-3H3/q+1