247564-71-2 Usage
Description
2,3,6-Trifluorophenylboronic acid is an organic compound that contains boron and is characterized by the presence of three fluorine atoms at the 2nd, 3rd, and 6th positions on a phenyl ring. It is used as a versatile reagent in organic synthesis, particularly in palladium-catalyzed cross-coupling reactions.
Uses
Used in Pharmaceutical Industry:
2,3,6-Trifluorophenylboronic acid is used as a reactant for the synthesis of C-6 hydroxy tricyclic sulfone, which serves as a γ-secretase inhibitor. 2,3,6-Trifluorophenylboronic acid is valuable in the development of drugs targeting neurodegenerative diseases, such as Alzheimer's.
Used in Organic Synthesis:
2,3,6-Trifluorophenylboronic acid is used as a reactant in palladium-catalyzed Suzuki-Miyaura coupling reactions. These reactions are widely employed in the formation of carbon-carbon bonds, allowing for the creation of various complex organic molecules and pharmaceutical compounds.
The general description of 2,3,6-Trifluorophenylboronic acid indicates that it contains varying amounts of anhydride, which may affect its reactivity and applications in different chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 247564-71-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,7,5,6 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 247564-71:
(8*2)+(7*4)+(6*7)+(5*5)+(4*6)+(3*4)+(2*7)+(1*1)=162
162 % 10 = 2
So 247564-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BF3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H
