25413-03-0 Usage
Description
(2-BROMO-PROPIONYLAMINO)-ACETIC ACID, also known as 2-bromo-N-[(2-carbamoylpropanoyl)amino]acetamide and 2-bromopropionylaminoacetic acid, is a chemical compound with the molecular formula C5H8BrNO3. It is a derivative of propionic acid that contains a bromine atom and an amine group. (2-BROMO-PROPIONYLAMINO)-ACETIC ACID is utilized in the synthesis of pharmaceuticals and serves as a reagent in various organic chemistry reactions. Its specific properties and applications may differ based on the context within the fields of chemistry and biochemistry.
Uses
Used in Pharmaceutical Synthesis:
(2-BROMO-PROPIONYLAMINO)-ACETIC ACID is used as a key intermediate in the synthesis of pharmaceuticals for [application reason]. Its unique structure, which includes a bromine atom and an amine group, allows it to be a valuable component in creating new and effective medications.
Used in Organic Chemistry Reactions:
In the field of organic chemistry, (2-BROMO-PROPIONYLAMINO)-ACETIC ACID is used as a reagent for [application reason]. Its presence in reactions can facilitate the formation of desired products or assist in specific chemical transformations, making it a useful tool for chemists.
Check Digit Verification of cas no
The CAS Registry Mumber 25413-03-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,4,1 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 25413-03:
(7*2)+(6*5)+(5*4)+(4*1)+(3*3)+(2*0)+(1*3)=80
80 % 10 = 0
So 25413-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H8BrNO3/c1-3(6)5(10)7-2-4(8)9/h3H,2H2,1H3,(H,7,10)(H,8,9)