26603-40-7 Usage
General Description
(2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(methyl-m-phenylene) isocyanate, also known as TMXDI, is a potentially hazardous chemical compound used in the production of polyurethane resins and coatings. It is a clear, colorless liquid that is highly reactive and can cause skin and eye irritation upon contact. TMXDI is classified as a diisocyanate, which means it can pose serious health risks if proper safety precautions are not followed, including respiratory issues and allergic reactions. Additionally, there are environmental concerns associated with its use, such as its potential to contribute to air and water pollution. Overall, TMXDI requires careful handling and proper protective measures in order to minimize its potential health and environmental impacts.
Check Digit Verification of cas no
The CAS Registry Mumber 26603-40-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,6,0 and 3 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 26603-40:
(7*2)+(6*6)+(5*6)+(4*0)+(3*3)+(2*4)+(1*0)=97
97 % 10 = 7
So 26603-40-7 is a valid CAS Registry Number.
InChI:InChI=1/C27H18N6O6/c1-16-4-7-19(10-22(16)28-13-34)31-25(37)32(20-8-5-17(2)23(11-20)29-14-35)27(39)33(26(31)38)21-9-6-18(3)24(12-21)30-15-36/h4-12H,1-3H3