26754-77-8 Usage
Description
3-Chloro-2,6-dihydroxybenzoic acid, with the chemical formula C7H5ClO4, is an organic compound characterized by the presence of a chloro group at the 3-position and two hydroxyl groups at the 2 and 6 positions on a benzene ring. It is a white solid and is known for its utility in various organic synthesis processes.
Uses
Used in Organic Synthesis:
3-Chloro-2,6-dihydroxybenzoic acid is used as a key intermediate in the synthesis of various organic compounds. Its unique structure, featuring a chloro and two hydroxyl groups, allows it to participate in a range of chemical reactions, making it a versatile building block for the creation of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-chloro-2,6-dihydroxybenzoic acid is utilized as a precursor for the development of new drugs. Its chemical properties enable it to be modified and incorporated into complex molecular structures, potentially leading to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Chemical Research:
3-Chloro-2,6-dihydroxybenzoic acid also serves as a valuable compound in chemical research, where it can be used to study reaction mechanisms, explore new synthetic routes, and develop innovative methodologies in organic chemistry.
Used in Agrochemical Development:
In the agrochemical sector, 3-chloro-2,6-dihydroxybenzoic acid is employed as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides. Its reactivity and functional groups make it suitable for the creation of compounds that can effectively control pests and weeds in agricultural settings.
Check Digit Verification of cas no
The CAS Registry Mumber 26754-77-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,7,5 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26754-77:
(7*2)+(6*6)+(5*7)+(4*5)+(3*4)+(2*7)+(1*7)=138
138 % 10 = 8
So 26754-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClO4/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2,9-10H,(H,11,12)