26956-47-8 Usage
Description
1-Benzyl-4-hydroxy-5-azaindole is a heterocyclic organic compound with a molecular formula C14H12N2O. It features a five-membered ring containing nitrogen and oxygen atoms, along with an aromatic benzyl group and a hydroxy substituent. 1-BENZYL-4-HYDROXY-5-AZAINDOLE has potential applications in pharmaceutical and medicinal chemistry due to its ability to interact with biological systems and potentially exhibit therapeutic properties. Its unique structural features also make it a valuable building block for the synthesis of more complex organic molecules.
Uses
Used in Pharmaceutical and Medicinal Chemistry:
1-Benzyl-4-hydroxy-5-azaindole is used as a chemical compound in pharmaceutical and medicinal chemistry for its potential therapeutic properties. Its ability to interact with biological systems makes it a promising candidate for drug discovery and development.
Used in Drug Discovery and Development:
1-Benzyl-4-hydroxy-5-azaindole is used as a building block in drug discovery and development due to its unique structural features. Its aromatic benzyl group and hydroxy substituent contribute to its chemical and biological properties, making it a subject of interest for the synthesis of more complex organic molecules with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 26956-47-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,9,5 and 6 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26956-47:
(7*2)+(6*6)+(5*9)+(4*5)+(3*6)+(2*4)+(1*7)=148
148 % 10 = 8
So 26956-47-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2O/c17-14-12-7-9-16(13(12)6-8-15-14)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,15,17)
26956-47-8Relevant articles and documents
One-pot synthesis of fused 2-pyridones from heteroarylacrylic acid via curtius rearrangement & microwave-assisted thermal electrocyclization
Nishiyama, Takashi,Hatae, Noriyuki,Hayashi, Kaori,Obata, Manami,Taninaka, Kimiko,Yamane, Masahiro,Oda, Shota,Abe, Takumi,Ishikura, Minoru,Hibino, Satoshi,Choshi, Tominari
, p. 251 - 267 (2017/07/28)
We investigated the one-pot synthesis of several fused 2-pyridone ring systems based on a Curtius rearrangement, followed by a microwave-assisted thermal electrocyclization of a 2-aza-6?-electron system including isocyanate. We synthesized seven heterocyclic compounds containing a fused 2-pyridone ring. In these results, the one-pot synthesis of fused 2-pyridone ring system 5 from (E)-acrylic acids 1 under microwave irradiation conditions was more effective than the conventional reaction conditions in terms of the yield and the reaction time.