27230-51-9 Usage
Description
4-Pyridylmercapto acetyl chloride hydrochloride is a white crystalline solid that serves as a crucial reagent in the chemical synthesis process. It is known for its significant role in the production of Cephalosporin derivatives, which are widely recognized for their antibiotic properties.
Uses
Used in Pharmaceutical Industry:
4-Pyridylmercapto acetyl chloride hydrochloride is used as a synthetic reagent for the production of Cephalosporin (C258750) derivatives. These derivatives are known for their antibiotic properties, making them essential in the development of medications to combat bacterial infections. The compound's role in this process is vital, as it contributes to the creation of effective antibiotics that can help treat a wide range of bacterial diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 27230-51-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,3 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 27230-51:
(7*2)+(6*7)+(5*2)+(4*3)+(3*0)+(2*5)+(1*1)=89
89 % 10 = 9
So 27230-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClNOS.ClH/c8-7(10)5-11-6-1-3-9-4-2-6;/h1-4H,5H2;1H
