27463-38-3 Usage
Description
5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE is an organic compound with the molecular formula C12H9ClO2. It is characterized by the presence of a cyclohexanone ring with a chlorophenyl group attached to the 5th position. 5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE is known for its potential applications in various chemical and pharmaceutical processes due to its unique structural properties.
Uses
Used in Chemical Synthesis:
5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows it to be a valuable building block for creating more complex molecules with specific properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE is used as a key component in the synthesis of 3-(5-(4-chlorophenyl)-3-oxocyclohex-1-enylamino)thiophene-2-carbonitrile. 5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE has potential applications in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Material Science:
The compound may also find applications in material science, where its unique structural properties could be utilized to develop new materials with specific characteristics, such as improved stability, reactivity, or selectivity in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 27463-38-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,4,6 and 3 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 27463-38:
(7*2)+(6*7)+(5*4)+(4*6)+(3*3)+(2*3)+(1*8)=123
123 % 10 = 3
So 27463-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClO2/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-4,9H,5-7H2
27463-38-3Relevant articles and documents
Tetrahydroquinazoline derivatives and pharmaceutical composition for preventing or treating psoriasis comprising the same
-
Paragraph 0217-0218; 0223-0225, (2020/11/06)
The present invention relates to a tetrahydroquinazoline derivative and a pharmaceutical composition for preventing or treating psoriasis containing the same as an active ingredient. The compound provided in one aspect of the present invention has an effe
Tandem reactions leading to benzo[c]chromen-6-ones and 3-substituted isocoumarins
Fan, Xuesen,He, Yan,Cui, Liangyan,Guo, Shenghai,Wang, Jianji,Zhang, Xinying
supporting information; experimental part, p. 673 - 677 (2012/03/10)
A simple and convenient protocol for the synthesis of benzo[c]chromen-6- ones and 3-substituted isocoumarins through a CuI-catalyzed tandem reaction of 2-bromobenzoates withcyclohexane-1,3-diones or acyclic 1,3-diones is developed. This strategy can also be extended to the one-pot synthesis of isoquinolin-1(2H)-one and 3,4-dihydrophenanthridine-1,6(2H,5H)-dione. A simple and convenient protocol for the synthesis of benzo[c]chromen-6-ones and 3-substituted isocoumarins through a CuI-catalyzed tandem reaction of 2-bromobenzoates with cyclohexane-1,3-dione or acyclic 1,3-dione has been developed. This strategy can also be extended to the one-pot synthesis of isoquionlin-1(2H)-one and 3,4-dihydrophenanthridine-1,6-(2H,5H)-dione. Copyright
