2805-55-2 Usage
Description
(E)-3-(2-fluorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one is a synthetic organic compound characterized by its molecular formula C15H10F2O. It is a ketone derivative featuring two fluorophenyl groups connected to a propenone backbone. This unique structure endows the compound with potential applications in medicinal chemistry and pharmaceuticals, where its biological activity and properties can be harnessed for various purposes.
Uses
Used in Medicinal Chemistry:
(E)-3-(2-fluorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with specific targeting and activity profiles, potentially leading to more effective treatments for a range of diseases.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (E)-3-(2-fluorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one is used as a key component in the design and development of novel therapeutic agents. Its incorporation into drug molecules can enhance their pharmacokinetic and pharmacodynamic properties, improving their efficacy and safety in treating specific medical conditions.
Used in Drug Delivery Systems:
(E)-3-(2-fluorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one may also be utilized in the development of advanced drug delivery systems. Its structural features can be exploited to improve the solubility, stability, and targeted delivery of therapeutic agents, thereby enhancing their bioavailability and overall therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 2805-55-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,0 and 5 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2805-55:
(6*2)+(5*8)+(4*0)+(3*5)+(2*5)+(1*5)=82
82 % 10 = 2
So 2805-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H10F2O/c16-13-8-5-12(6-9-13)15(18)10-7-11-3-1-2-4-14(11)17/h1-10H/b10-7+
