28128-19-0 Usage
General Description
2-Mercaptopurine is a cytotoxic drug that is commonly used in the treatment of certain types of cancer, particularly leukemia. It works by inhibiting the synthesis of DNA and RNA, which ultimately impairs the growth of cancer cells. 2-Mercaptopurine is a purine analog, meaning it is similar in structure to the building blocks of DNA and RNA. Its mechanism of action involves being incorporated into the DNA and RNA molecules, which disrupts their normal function. This can lead to the death of rapidly dividing cancer cells. 2-Mercaptopurine is often used in combination with other chemotherapy agents and is administered under the guidance of a healthcare professional due to its potential for serious side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 28128-19-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,1,2 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28128-19:
(7*2)+(6*8)+(5*1)+(4*2)+(3*8)+(2*1)+(1*9)=110
110 % 10 = 0
So 28128-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N4S/c10-5-6-1-3-4(9-5)8-2-7-3/h1-3H,(H,7,8,9,10)
