28583-72-4 Usage
General Description
N1-(3-HYDROXY-4-PROPYLPHENYL)ACETAMIDE is a chemical compound that belongs to the class of acetamide. It is also known as 3-(4-hydroxy-3-propylphenyl)acetamide and has the molecular formula C11H15NO2. This chemical is a derivative of acetamide and contains a hydroxy group and a propyl group attached to a phenyl ring. It is commonly used in research and pharmaceuticals for its potential therapeutic properties, including its anti-inflammatory and analgesic effects. However, further research is needed to fully understand its medicinal potential and any potential side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 28583-72-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,5,8 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 28583-72:
(7*2)+(6*8)+(5*5)+(4*8)+(3*3)+(2*7)+(1*2)=144
144 % 10 = 4
So 28583-72-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2/c1-3-4-9-5-6-10(7-11(9)14)12-8(2)13/h5-7,14H,3-4H2,1-2H3,(H,12,13)
