292067-84-6 Usage
General Description
The chemical compound "(Z)-N-(3-(dimethylamino)-2-(trifluoromethyl)allylidene)-N-methylmethanaminium hexafluorophosphate" is a positively charged molecule with a hexafluorophosphate anion. It contains a dimethylamino group, a trifluoromethyl group, and an allylidene group, all of which are attached to a central N-methylmethanaminium core. The compound is highly polar and soluble in polar solvents due to the presence of charged groups. It may be used in organic synthesis as a reagent or catalyst, and its trifluoromethyl group can impart unique chemical reactivity to the molecule. Additionally, the hexafluorophosphate anion can participate in ionic interactions with other charged species, contributing to its potential use in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 292067-84-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,2,0,6 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 292067-84:
(8*2)+(7*9)+(6*2)+(5*0)+(4*6)+(3*7)+(2*8)+(1*4)=156
156 % 10 = 6
So 292067-84-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H14BrN2.F6P/c1-9(2)5-7(8)6-10(3)4;1-7(2,3,4,5)6/h5-6H,1-4H3;/q+1;-1
