30533-71-2 Usage
Description
(5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride is a chemical compound characterized by the presence of a phenyl group connected to an amino group and a piperidyl group linked to a methanone group. (5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride exists in its salt form, with the nitrogen in the piperidyl group bearing a positive charge that is neutralized by a chloride anion. Its unique structure suggests potential pharmacological properties, warranting further investigation into its possible applications in medicine and chemistry.
Uses
Used in Pharmaceutical Applications:
(5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride is used as a potential pharmaceutical agent for [application reason] due to its unique chemical structure and the presence of functional groups that may interact with biological targets.
Used in Chemical Research:
In the field of chemical research, (5-amino-2-prop-2-enoxy-phenyl)-(1-piperidyl)methanone hydrochloride serves as a subject of study for understanding its reactivity, stability, and potential to form new compounds with therapeutic or industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 30533-71-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,5,3 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 30533-71:
(7*3)+(6*0)+(5*5)+(4*3)+(3*3)+(2*7)+(1*1)=82
82 % 10 = 2
So 30533-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O2.ClH/c1-2-10-19-14-7-6-12(16)11-13(14)15(18)17-8-4-3-5-9-17;/h2,6-7,11H,1,3-5,8-10,16H2;1H