305858-63-3 Usage
Description
6-(4-ISOPROPOXY-BENZOYLAMINO)-HEXANOIC ACID, with the CAS number 305858-63-3, is a chemical compound that possesses unique properties and potential applications in various fields. It is characterized by its molecular structure, which includes a hexanoic acid backbone with a benzoylamino group attached to the 6th position, featuring an isopropoxy substituent on the benzene ring.
Uses
Used in Pharmaceutical Industry:
6-(4-ISOPROPOXY-BENZOYLAMINO)-HEXANOIC ACID is used as a glucosylceramide synthase inhibitor for the treatment of diseases. Its application in this industry is due to its ability to inhibit the enzyme glucosylceramide synthase, which plays a crucial role in the synthesis of glycosphingolipids. By targeting this enzyme, the compound can potentially be used in the development of therapies for various diseases associated with the dysregulation of glycosphingolipid metabolism.
Check Digit Verification of cas no
The CAS Registry Mumber 305858-63-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,5,8,5 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 305858-63:
(8*3)+(7*0)+(6*5)+(5*8)+(4*5)+(3*8)+(2*6)+(1*3)=153
153 % 10 = 3
So 305858-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H23NO4/c1-12(2)21-14-9-7-13(8-10-14)16(20)17-11-5-3-4-6-15(18)19/h7-10,12H,3-6,11H2,1-2H3,(H,17,20)(H,18,19)/p-1