30796-85-1 Usage
Description
2-(5-methyl-2-furyl)ethanamine is an organic compound characterized by its unique chemical structure, which features a furyl group attached to an ethanamine backbone. This molecule has garnered interest due to its potential applications in various fields, particularly as a modulator of biological receptors.
Uses
Used in Pharmaceutical Industry:
2-(5-methyl-2-furyl)ethanamine is used as a diarylurea-based cannabinoid 1 receptor (CB1R) allosteric modulator for its ability to improve the potency and pharmacokinetic properties of such modulators. This application is significant in the development of novel therapeutics targeting the CB1R, which plays a crucial role in various physiological processes and is associated with conditions such as obesity, pain, and neurodegenerative diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 30796-85-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,7,9 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 30796-85:
(7*3)+(6*0)+(5*7)+(4*9)+(3*6)+(2*8)+(1*5)=131
131 % 10 = 1
So 30796-85-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO/c1-6-2-3-7(9-6)4-5-8/h2-3H,4-5,8H2,1H3
