3082-93-7 Usage
Description
[[5-[(Acetyloxy)methyl]-1-phenyl-1H-pyrazol-3-yl]methylene]phenylhydrazide acetic acid is a complex organic chemical compound characterized by its multiple functional groups and diverse chemical structure. It features a pyrazole ring, a phenyl ring, and an acetic acid group, along with an acetyloxy group, a methylene group, and a hydrazide group. This intricate arrangement of components suggests potential applications in various sectors, such as pharmaceuticals, organic synthesis, and materials science, due to its versatile reactivity and properties.
Uses
Used in Pharmaceutical Industry:
[[5-[(Acetyloxy)methyl]-1-phenyl-1H-pyrazol-3-yl]methylene]phenylhydrazide acetic acid is used as a potential pharmaceutical compound for its diverse functional groups, which may contribute to the development of new drugs with specific therapeutic properties. [[5-[(Acetyloxy)methyl]-1-phenyl-1H-pyrazol-3-yl]methylene]phenylhydrazide acetic acid's structure could be exploited to target various biological pathways or receptors, offering novel treatment options for a range of diseases.
Used in Organic Synthesis:
In the field of organic synthesis, [[5-[(Acetyloxy)methyl]-1-phenyl-1H-pyrazol-3-yl]methylene]phenylhydrazide acetic acid serves as a valuable intermediate or building block for the creation of more complex molecules. Its multiple functional groups provide opportunities for further chemical reactions and modifications, enabling the synthesis of a wide array of organic compounds with tailored properties and applications.
Used in Materials Science:
[[5-[(Acetyloxy)methyl]-1-phenyl-1H-pyrazol-3-yl]methylene]phenylhydrazide acetic acid may also find applications in materials science, where its unique structure could be utilized to develop new materials with specific characteristics. These materials could have potential uses in various industries, such as electronics, coatings, or adhesives, depending on the properties conferred by the compound's functional groups and overall structure.
Check Digit Verification of cas no
The CAS Registry Mumber 3082-93-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,8 and 2 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3082-93:
(6*3)+(5*0)+(4*8)+(3*2)+(2*9)+(1*3)=77
77 % 10 = 7
So 3082-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H20N4O3/c1-16(26)24(19-9-5-3-6-10-19)22-14-18-13-21(15-28-17(2)27)25(23-18)20-11-7-4-8-12-20/h3-14H,15H2,1-2H3/b22-14+
3082-93-7Relevant articles and documents
Preparative scale conversion of D-xylose into hydrophilically functionalized pyrazoles
Diehl, Volker,Cuny, Eckehard,Lichtenthaler, Frieder W.
, p. 1193 - 1201 (2007/10/03)
An expeditious, 4-step procedure is described for the conversion of bulk-scale accessible D-xylose into 5-hydroxymethyl-1-phenylpyrazole-3-carboxaldehyde (3), which, in turn, is converted into various pyrazole building blocks with versatile application profiles, such as the l-phenylpyrazole-3,5-dicarboxylic acid (9), the respective 3,5-dialdehyde (10), and 3,5-bis(aminomethyl)-l-phenylpyrazole(13).