31107-39-8 Usage
Chemical class
benzimidazobenzisoquinolinium compounds
Contains
quaternary ammonium cation
Potential pharmacological properties
antimalarial, anticancer, modulation of ion channels in the central nervous system
Unique chemical structure
may have other undiscovered pharmacological properties
Further research needed
to fully understand potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 31107-39-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,1,0 and 7 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 31107-39:
(7*3)+(6*1)+(5*1)+(4*0)+(3*7)+(2*3)+(1*9)=68
68 % 10 = 8
So 31107-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H15N2O2.ClH/c1-21-16-10-9-13(24-2)11-17(16)22-19(21)14-7-3-5-12-6-4-8-15(18(12)14)20(22)23;/h3-11H,1-2H3;1H/q+1;/p-1