314029-36-2 Usage
General Description
2-Amino-4-fluoro-6-phenoxypyrimidine is a chemical compound that belongs to the pyrimidine class of organic compounds. It is characterized by the presence of an amino group at the 2-position, a fluorine atom at the 4-position, and a phenoxypyrimidine group at the 6-position. 2-Amino-4-fluoro-6-phenoxypyrimidine has potential applications in the field of pharmaceuticals and agrochemicals due to its ability to act as an intermediate in the synthesis of various biologically active compounds and pharmaceutical agents. It also possesses significant biological activity, making it a valuable tool for the development of new drugs and agricultural chemicals. Additionally, its unique structure and properties make it a subject of interest in the field of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 314029-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,4,0,2 and 9 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 314029-36:
(8*3)+(7*1)+(6*4)+(5*0)+(4*2)+(3*9)+(2*3)+(1*6)=102
102 % 10 = 2
So 314029-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8FN3O/c11-8-6-9(14-10(12)13-8)15-7-4-2-1-3-5-7/h1-6H,(H2,12,13,14)
