3247-70-9 Usage
General Description
2-CHLOROMETHYL-5-(4-CHLOROPHENYL)-1,3,4-THIADIAZOLE is a chemical compound that belongs to the class of thiadiazole derivatives. It is a white crystalline solid with the molecular formula C10H6Cl2N2S and a molecular weight of 259.14 g/mol. 2-CHLOROMETHYL-5-(4-CHLOROPHENYL)-1,3,4-THIADIAZOLE has potential applications in the pharmaceutical industry, specifically in the development of new drugs. Its unique molecular structure and properties make it a target for medicinal chemistry research. Additionally, its chlorine atoms and thiadiazole ring make it a versatile building block for the synthesis of various biologically active compounds. However, its specific uses and potential biological activities are still under investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 3247-70-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,4 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3247-70:
(6*3)+(5*2)+(4*4)+(3*7)+(2*7)+(1*0)=79
79 % 10 = 9
So 3247-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N2S/c1-3-2-5-4(7)6-3/h2H,1H3,(H2,5,6,7)
