328546-66-3 Usage
General Description
9-AMINO-1,2,3,4-TETRAHYDRO-BENZO[E][1,4]DIAZEPIN-5-ONE is a chemical compound with the molecular formula C10H10N2O. It is a heterocyclic compound that contains a benzodiazepine ring and an amino group. 9-AMINO-1,2,3,4-TETRAHYDRO-BENZO[E][1,4]DIAZEPIN-5-ONE is often used in pharmaceutical research and drug development, particularly in the study of central nervous system disorders and the development of potential therapeutic agents. It may also have applications in the field of organic synthesis and medicinal chemistry due to its structural features and potential pharmacological properties. Additionally, it may have potential use in the development of new psychotherapeutic drugs due to its similarity to other benzodiazepine compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 328546-66-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,8,5,4 and 6 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 328546-66:
(8*3)+(7*2)+(6*8)+(5*5)+(4*4)+(3*6)+(2*6)+(1*6)=163
163 % 10 = 3
So 328546-66-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N3O/c10-7-3-1-2-6-8(7)11-4-5-12-9(6)13/h1-3,11H,4-5,10H2,(H,12,13)