330-48-3 Usage
Description
N-(3,4-difluorophenyl)-3,4-difluoro-aniline is a chemical compound with the molecular formula C6H4F4N. It is a substituted aniline derivative characterized by the presence of two fluorine atoms on both the phenyl ring and the amino group. This unique structure endows it with specific properties that make it valuable in various applications.
Uses
Used in Pharmaceutical Synthesis:
N-(3,4-difluorophenyl)-3,4-difluoro-aniline serves as a key building block in the development of pharmaceuticals. Its unique structure allows for the creation of new drug candidates with potential therapeutic benefits.
Used in Agrochemical Production:
In the agrochemical industry, N-(3,4-difluorophenyl)-3,4-difluoro-aniline is utilized in the synthesis of various compounds that contribute to crop protection and enhancement of agricultural yields.
Used in Dye Manufacturing:
N-(3,4-difluorophenyl)-3,4-difluoro-aniline is also employed in the production of dyes, where its distinctive properties can be harnessed to create dyes with specific color characteristics and stability.
Used in Organic Synthesis:
N-(3,4-difluorophenyl)-3,4-difluoro-aniline is a valuable reagent in organic synthesis, facilitating a range of chemical reactions that can lead to the formation of diverse organic compounds.
Used in Materials Science:
Its potential applications extend to materials science, where it may contribute to the development of new materials with unique properties.
Used as a Precursor in Synthetic Methods:
Furthermore, N-(3,4-difluorophenyl)-3,4-difluoro-aniline acts as a precursor in the development of innovative synthetic methods, expanding the scope of chemical synthesis.
Safety Note:
Given its toxic and potentially hazardous nature, it is crucial to exercise proper care in handling and storing N-(3,4-difluorophenyl)-3,4-difluoro-aniline to ensure safety and prevent adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 330-48-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,3 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 330-48:
(5*3)+(4*3)+(3*0)+(2*4)+(1*8)=43
43 % 10 = 3
So 330-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H7F4N/c13-9-3-1-7(5-11(9)15)17-8-2-4-10(14)12(16)6-8/h1-6,17H