330645-87-9 Usage
Description
5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is a chemical compound that serves as a versatile reagent in various organic synthesis processes. It is characterized by its unique structure, which includes a chloro-substituted benzotriazole core and a hexafluorophosphate counterion. 5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is known for its ability to facilitate a range of chemical reactions, making it a valuable tool in the field of organic chemistry.
Uses
Used in Organic Synthesis:
5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is used as a reagent for the synthesis of near-infrared pH activatable fluorescent probes. Its unique properties enable the development of probes that can be activated under specific pH conditions, making them useful for various applications, such as imaging and sensing.
Used in Peptide Synthesis:
In the field of peptide synthesis, 5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is used for the synthesis of human β-amyloid using Fmoc chemistry. This reagent aids in the efficient and selective formation of peptide bonds, which is crucial for the production of complex peptide structures.
Used in Olefination Reactions:
5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is also employed as a reagent in stereoselective Horner-Wadsworth-Emmons olefination reactions. It provides a reliable method for the formation of carbon-carbon double bonds with high selectivity, which is essential for the synthesis of complex organic molecules.
Used in Bioconjugation:
5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is used for the covalent ligation of fluorescent peptides to quantum dots. This process allows for the creation of hybrid materials with unique optical and electronic properties, which can be applied in various fields, such as nanotechnology and bioimaging.
Used in DNA Modification:
In the area of DNA modification, this reagent is used for the alkylation of the human telomere sequence. This process can lead to the development of new therapeutic strategies targeting telomere maintenance mechanisms, which are important in aging and cancer research.
Overall, 5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate is a versatile reagent with a wide range of applications in organic synthesis, peptide synthesis, olefination reactions, bioconjugation, and DNA modification. Its unique properties and ability to facilitate various chemical reactions make it an invaluable tool for researchers in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 330645-87-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,0,6,4 and 5 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 330645-87:
(8*3)+(7*3)+(6*0)+(5*6)+(4*4)+(3*5)+(2*8)+(1*7)=129
129 % 10 = 9
So 330645-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15ClN5O.F5P.FH/c1-15(2)11(16(3)4)18-17-10-7-8(12)5-6-9(10)13-14-17;1-6(2,3,4)5;/h5-7H,1-4H3;;1H/q+1;;/p-1
