331818-83-8 Usage
Description
2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane, also known as IPEPID, is a halogenated ether with the molecular formula C8H16O2I. It features a three-carbon chain with an iodine atom and two methyl groups, making it a versatile chemical compound used in various scientific and industrial applications.
Uses
Used in Organic Synthesis:
2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane is used as a solvent and reagent in organic synthesis for its ability to dissolve a wide range of organic compounds and facilitate various chemical reactions.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane is used as a reagent in the development of new drugs, particularly due to its antimicrobial properties and potential for drug discovery.
Used in Antimicrobial Applications:
2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane is used as an antimicrobial agent for its ability to inhibit the growth of various microorganisms, making it a promising candidate for applications in healthcare and sanitation.
Used in Polymer Chemistry:
In the field of polymer chemistry, 2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane is used as a monomer or intermediate in the synthesis of polymers with unique properties, such as improved stability or specific functionalities.
Used in Material Science:
2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane is used in material science for its potential to contribute to the development of new materials with enhanced properties, such as improved thermal stability or specific chemical reactivity.
Overall, 2-(3-Iodopropyl)-5,5-dimethyl-1,3-dioxane, or IPEPID, is a chemical compound with a broad spectrum of applications across various industries, including organic synthesis, pharmaceutical research, antimicrobial applications, polymer chemistry, and material science. Its unique chemical structure and properties make it a valuable asset for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 331818-83-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,1,8,1 and 8 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 331818-83:
(8*3)+(7*3)+(6*1)+(5*8)+(4*1)+(3*8)+(2*8)+(1*3)=138
138 % 10 = 8
So 331818-83-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H17IO2/c1-9(2)6-11-8(12-7-9)4-3-5-10/h8H,3-7H2,1-2H3
