33368-94-4 Usage
General Description
4-Imidazolidinone, 5-methyl-2-thioxo (9CI) is a chemical compound with the molecular formula C5H8N2OS. It is a heterocyclic compound and a derivative of imidazolidinone. 4-Imidazolidinone,5-methyl-2-thioxo-(9CI) is known for its potential use as a pharmaceutical intermediate and as a building block in organic synthesis. It has the ability to form hydrogen bonds and has been studied for its potential applications in drug design and development. Additionally, it has been found to exhibit antimicrobial and antioxidant properties, making it potentially useful in the field of medicinal chemistry. Overall, 4-Imidazolidinone, 5-methyl-2-thioxo (9CI) is a versatile chemical compound with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 33368-94-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,3,6 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 33368-94:
(7*3)+(6*3)+(5*3)+(4*6)+(3*8)+(2*9)+(1*4)=124
124 % 10 = 4
So 33368-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N2OS/c1-2-3(7)6-4(8)5-2/h2H,1H3,(H2,5,6,7,8)
