33403-37-1 Usage
Description
Nornidulin is a depsidone compound produced by several fungal species. It is closely related to folipasatin and unguinol, which are known for their inhibitory effects on phospholipase A2, arachidonic acid release, and nitrendipine binding. Nornidulin exhibits potent and selective antibacterial activity, as well as some calcium-blocking attributes, making it a potential candidate for anti-inflammatory applications.
Uses
Used in Pharmaceutical Industry:
Nornidulin is used as a potent, selective antibacterial agent for targeting and eliminating specific bacteria. Its potent antibacterial activity makes it a valuable compound in the development of new antibiotics to combat drug-resistant infections.
Used in Anti-Inflammatory Applications:
Nornidulin is used as a potential anti-inflammatory agent due to its calcium-blocking attributes. This property may contribute to the development of novel treatments for various inflammatory conditions, such as arthritis, asthma, and other autoimmune diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 33403-37-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,4,0 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 33403-37:
(7*3)+(6*3)+(5*4)+(4*0)+(3*3)+(2*3)+(1*7)=81
81 % 10 = 1
So 33403-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H15Cl3O5/c1-5-6(2)9-12(21)14(23)8(4)16-18(9)26-17-10(19(25)27-16)7(3)11(20)15(24)13(17)22/h5,23-24H,1-4H3