34004-14-3 Usage
Description
METHYL ALPHA-D-GALACTOPYRANOSIDE MONOHYDRATE is a white to cream crystalline powder that is utilized in various applications across different industries, including medicine and the chemical industry. Its unique chemical properties make it a valuable compound for a range of uses.
Uses
Used in Pharmaceutical Industry:
METHYL ALPHA-D-GALACTOPYRANOSIDE MONOHYDRATE is used as an active pharmaceutical ingredient for the development of drugs targeting specific medical conditions. Its unique chemical structure allows it to interact with biological systems, making it a promising candidate for the creation of novel therapeutic agents.
Used in Chemical Industry:
METHYL ALPHA-D-GALACTOPYRANOSIDE MONOHYDRATE is used as a key intermediate in the synthesis of various chemical compounds. Its versatility in chemical reactions enables the production of a wide range of products, contributing to the advancement of the chemical industry.
Used in Research and Development:
METHYL ALPHA-D-GALACTOPYRANOSIDE MONOHYDRATE is employed as a research tool in the study of carbohydrate chemistry, biochemistry, and molecular biology. Its unique properties make it an essential compound for understanding the structure and function of complex biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 34004-14-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,0,0 and 4 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 34004-14:
(7*3)+(6*4)+(5*0)+(4*0)+(3*4)+(2*1)+(1*4)=63
63 % 10 = 3
So 34004-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H14O6.H2O/c1-12-7-6(11)5(10)4(9)3(2-8)13-7;/h3-11H,2H2,1H3;1H2/t3-,4+,5+,6-,7+;/m1./s1
