3415-35-8 Usage
Description
4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE is an organic compound belonging to the class of 1,4-benzodiazepines. It is characterized by its unique chemical structure, which features a benzene ring fused to a diazepine ring, with an additional methyl group at the 4-position and a cyclopropane ring attached to the 3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione core. 4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE is known for its potential applications in various fields, particularly in the synthesis of pharmaceuticals and other organic compounds.
Uses
Used in Pharmaceutical Synthesis:
4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE is used as a reactant in the synthetic preparation of various 3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione derivatives. These derivatives are of significant interest due to their potential therapeutic properties, including anxiolytic, sedative, and muscle relaxant effects. 4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE serves as a key intermediate in the development of new drugs targeting central nervous system disorders.
Used in Organic Chemistry:
In the field of organic chemistry, 4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE is utilized as a versatile building block for the synthesis of more complex organic molecules. Its unique structure allows for further functionalization and modification, enabling the creation of a wide range of compounds with diverse applications, such as agrochemicals, dyes, and advanced materials.
Used in Cyclopropanation Reactions:
4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE is also employed in cyclopropanation reactions, which involve the formation of a cyclopropane ring from a double bond. This process is crucial in the synthesis of various organic compounds, including pharmaceuticals, natural products, and other bioactive molecules. 4-METHYL-3,4-DIHYDRO-1H-BENZO[E][1,4]DIAZEPINE-2,5-DIONE's ability to participate in cyclopropanation reactions makes it a valuable tool in the development of novel chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 3415-35-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,1 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3415-35:
(6*3)+(5*4)+(4*1)+(3*5)+(2*3)+(1*5)=68
68 % 10 = 8
So 3415-35-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O2/c1-12-6-9(13)11-8-5-3-2-4-7(8)10(12)14/h2-5H,6H2,1H3,(H,11,13)
3415-35-8Relevant articles and documents
A ONE STEP SYNTHESIS OF 1,4-BENZODIAZEPINES:SYNTHETIC STUDIES ON NEOTHRAMYCIN
Mori, Miwako,Kimura, Masaya,Uozumi, Yasuhiro,Ban, Yoshio
, p. 5947 - 5950 (2007/10/02)
A one step synthesis of 1,4-benzodiazepines from o-haloanilines and amino acids was achieved by use of palladium catalyzed carbonylation, by which application a synthesis of the model compounds (23a and 23b) of Neothramycin (A and B) was described.An efficient chemoselective reduction of the amide was provided.
