34840-23-8 Usage
Description
1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudourea is a thiourea derivative, which is an organic compound characterized by the presence of a thiocarbonyl group (C=S) instead of a carbonyl group (C=O) in its structure. 1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudoeura is known for its potential applications in various chemical syntheses and pharmaceutical development.
Uses
1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudourea is used as an intermediate in the synthesis of various compounds for different purposes. The expression is: 1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudourea is used as [application type] for [application reason]
Used in Pharmaceutical Synthesis:
1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudourea is used as a key intermediate in the synthesis of pharmaceutical compounds, such as:
1. Methyl (6-methyl-4-oxo-4,5-dihydro-3H-pyrrolo[3,2-d]pyrimidin-2-yl)carbamate: 1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudoeura is synthesized for its potential applications in the development of new drugs targeting various diseases.
2. 2-amino-5-benzyl-6-methyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one: This molecule is synthesized for its potential use in the creation of novel therapeutic agents.
3. Methyl-5-[(3-hydroxypropyl)thio]-1H-benzo[d]imidazol-2-ylcarbamate (hydroxyalbendazole): 1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudoeura is synthesized for its potential applications in the treatment of parasitic infections.
4. Methyl-5-[(4-hydroxyphenyl)thio]-1H-benzo[d]imidazol-2-yl carbamate (hydroxyfenbendazole): This molecule is synthesized for its potential use in the development of new anthelmintic drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 34840-23-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,8,4 and 0 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 34840-23:
(7*3)+(6*4)+(5*8)+(4*4)+(3*0)+(2*2)+(1*3)=108
108 % 10 = 8
So 34840-23-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2O4S/c1-11-5(9)7-4(13-3)8-6(10)12-2/h1-3H3,(H,7,8,9,10)
34840-23-8Relevant articles and documents
PYRAZOLE-OXAZOLIDINONE COMPOUND FOR ANTI-HEPATITIS B VIRUS
-
Paragraph 0397-0399, (2019/06/07)
The present invention discloses a pyrazole-oxazolidinone compound having anti-hepatitis B virus activity, which has the structure of formula (I), wherein each variable is as defined herein.
Synthesis and antiviral evaluation of benzimidazoles, quinoxalines and indoles from dehydroabietic acid
Fonseca, Tatiana,Gigante, Barbara,Marques, M. Matilde,Gilchrist, Thomas L.,De Clercq, Erik
, p. 103 - 112 (2007/10/03)
Several heterocycles, such as benzimidazoles, quinoxalines and indoles incorporated into a hydrophenanthrene and naphthalene skeleton, were synthesised from two useful ortho-bromonitro precursors derived from dehydroabietic acid: methyl 12-bromo-13-nitro-deisopropyldehydroabietate and methyl 12-bromo-13,14-dinitro-deisopropyldehydroabietate. The new heterocycles were evaluated for their activity in vitro against several RNA and DNA viruses.
Process for the preparation of 9-deazaguanine derivatives
-
, (2008/06/13)
Derivatives of 9-deazaguanine are prepared by reacting an aldehyde or ketone with a dialkylaminomalonate to form the corresponding enamine. The enamine is then reacted with a base to form a cyclic pyrrole. The cyclic pyrrole is reacted with an urea compound to provide a protected guanidino compound. The guanidino is converted to the desired 9-deazaguanine derivative by reacting with trifluoracetic acid or with an alkoxide or hydroxide followed by neutralization with an acid.