3489-06-3 Usage
Description
(3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester is a complex organic compound derived from the plant Cabucala fasciculata. It is an alkaloid that has been investigated for its potential applications and properties. (3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester forms colorless crystals and has a specific rotation of [α]D + 31.7° (CHC13).
Uses
Used in Pharmaceutical Industry:
(3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester is used as a pharmaceutical compound for its potential therapeutic applications. (3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester's unique structure and properties make it a promising candidate for further research and development in the pharmaceutical field.
Used in Chemical Research:
(3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester is used as a research compound for studying its chemical properties, interactions, and potential applications in various fields. Its complex structure and unique characteristics make it an interesting subject for chemical research.
Used in Drug Delivery Systems:
Similar to gallotannin, (3β,7S,20α)-11-Methoxy-19α-methyl-2-oxoformosanan-16-carboxylic acid methyl ester could potentially be used in drug delivery systems. Novel drug delivery systems could be developed to enhance the compound's applications and efficacy, improving its delivery, bioavailability, and therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 3489-06-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,8 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3489-06:
(6*3)+(5*4)+(4*8)+(3*9)+(2*0)+(1*6)=103
103 % 10 = 3
So 3489-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N2O5/c1-12-15-10-24-7-6-22(17-5-4-13(27-2)8-18(17)23-21(22)26)19(24)9-14(15)16(11-29-12)20(25)28-3/h4-5,8,11-12,14-15,19H,6-7,9-10H2,1-3H3,(H,23,26)/t12-,14-,15-,19+,22-/m0/s1